Others
1-[2-[[2-cyano-3-[4-(dimethylamino)phenyl]-1-oxoallyl]oxy]ethyl]pyridinium chloride
- CAS No.: 62984-74-1
- Purity: 99%
Factory Supply Industrial Grade 1-[2-[[2-cyano-3-[4-(dimethylamino)phenyl]-1-oxoallyl]oxy]ethyl]pyridinium chloride 62984-74-1 with Best Price
- Molecular Formula: C19H20ClN3O2
- Molecular Weight: 357.834
- Boiling Point: °Cat760mmHg
- Flash Point: °C
- PSA: 57.21000
- Density: g/cm3
- LogP: -0.80552
1-[2-[[2-cyano-3-[4-(dimethylamino)phenyl]-1-oxoallyl]oxy]ethyl]pyridinium chloride(Cas 62984-74-1) Usage
|
Chemical structure |
A complex chemical compound with a long and specific name. |
|
Pyridinium chloride compound |
Contains a pyridinium group and a chloride ion. |
|
Cyano group |
Contains a carbon-nitrogen triple bond (C≡N). |
|
Dimethylamino group |
Contains two methyl groups (CH3) attached to a nitrogen atom (N). |
|
Allyl group |
A group derived from propene, with a double bond and a single bond to the rest of the molecule. |
|
Oxo group |
A carbonyl group (C=O) attached to a carbon atom. |
|
Laboratory research |
Commonly used in laboratory research for various purposes. |
|
Medical applications |
Utilized in the field of pharmaceuticals. |
|
Potentially hazardous |
Important to handle and use with care and under proper guidance due to its potentially hazardous nature. |
|
General Description |
1-[2-[[2-cyano-3-[4-(dimethylamino)phenyl]-1-oxoallyl]oxy]ethyl]pyridinium chloride is a complex chemical compound with a long and specific name. It is a pyridinium chloride compound that contains a cyano group and a dimethylamino group, as well as an allyl group and an oxo group. 1-[2-[[2-cyano-3-[4-(dimethylamino)phenyl]-1-oxoallyl]oxy]ethyl]pyridinium chloride is commonly used in laboratory research and medical applications, especially in the field of pharmaceuticals. Its specific chemical structure and properties make it useful for various purposes, and it is important to handle and use this compound with care and under proper guidance, due to its potentially hazardous nature. |
InChI:InChI=1/C19H20N3O2.ClH/c1-21(2)18-8-6-16(7-9-18)14-17(15-20)19(23)24-13-12-22-10-4-3-5-11-22;/h3-11,14H,12-13H2,1-2H3;1H/q+1;/p-1/b17-14+;
RELATED PRODUCTS